ChemNet > CAS > 937-00-8 3-(trifluoromethyl)thiophenol
937-00-8 3-(trifluoromethyl)thiophenol
| उत्पाद का नाम |
3-(trifluoromethyl)thiophenol |
| अंग्रेजी नाम |
3-(trifluoromethyl)thiophenol; 3-(Trifluoromethyl)benzenethiol; 1-bromo-5-chloro-2-fluoro-4-methylbenzene; 3-Trifluoromethyl thiophenol |
| आणविक फार्मूला |
C7H5BrClF |
| आण्विक वजन |
223.47 |
| InChI |
InChI=1/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3 |
| कैस रजिस्टी संख्या |
937-00-8 |
| आणविक संरचना |
|
| घनत्व |
1.618g/cm3 |
| उबलने का समय |
221.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.545 |
| फ्लैश प्वाइंट |
87.5°C |
| वाष्प का दबाव |
0.162mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
