998-29-8 Tri-n-propylsilane
उत्पाद का नाम |
Tri-n-propylsilane |
अंग्रेजी नाम |
Tri-n-propylsilane; Silane, tripropyl-; NSC 96837; Tripropylsilane; tripropylsilyl |
आणविक फार्मूला |
C9H21Si |
आण्विक वजन |
157.3485 |
InChI |
InChI=1/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
कैस रजिस्टी संख्या |
998-29-8 |
EINECS |
213-649-1 |
आणविक संरचना |
|
खतरा प्रतीक |
|
खतरे के कोड |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|