10047-28-6 butyl thioglycolate
نام محصول |
butyl thioglycolate |
نام انگلیسی |
butyl thioglycolate; |
میدان مغناطیسی |
C6H12O2S |
وزن مولکولی |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
شماره سیایاس |
10047-28-6 |
تعداد کمیسیون اروپایی |
233-156-5 |
ساختار مولکولی |
|
تراکم |
1.088g/cm3 |
نقطه غلیان |
220.125°C at 760 mmHg |
ضریب شکست |
1.491 |
نقطه اشتعال |
86.929°C |
فشار بخار |
0.024mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|