101-17-7 3-Chlorodiphenylamine
نام محصول |
3-Chlorodiphenylamine |
نام انگلیسی |
3-Chlorodiphenylamine; Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
میدان مغناطیسی |
C12H10ClN |
وزن مولکولی |
203.6675 |
InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
شماره سیایاس |
101-17-7 |
تعداد کمیسیون اروپایی |
202-922-0 |
ساختار مولکولی |
|
تراکم |
1.216g/cm3 |
نقطه غلیان |
337.8°C at 760 mmHg |
ضریب شکست |
1.642 |
نقطه اشتعال |
147.4°C |
فشار بخار |
0.000102mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|