101-99-5 N-Phenylurethane
نام محصول |
N-Phenylurethane |
نام انگلیسی |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
میدان مغناطیسی |
C9H11NO2 |
وزن مولکولی |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
شماره سیایاس |
101-99-5 |
تعداد کمیسیون اروپایی |
202-995-9 |
ساختار مولکولی |
|
تراکم |
1.136g/cm3 |
نقطه غلیان |
238°C at 760 mmHg |
ضریب شکست |
1.558 |
نقطه اشتعال |
79.2°C |
فشار بخار |
0.0434mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|