10192-85-5 Potassium acrylate
نام محصول |
Potassium acrylate |
نام انگلیسی |
Potassium acrylate; PotassiumAcrylateinmethanol; Potassiumacrylate; Acrylic acid potassium salt; 2-Propenoic acid, potassium salt; prop-2-enoic acid; potassium prop-2-enoate |
میدان مغناطیسی |
C3H3KO2 |
وزن مولکولی |
110.153 |
InChI |
InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
شماره سیایاس |
10192-85-5 |
تعداد کمیسیون اروپایی |
233-473-9 |
ساختار مولکولی |
|
نقطه ذوب |
194℃ |
نقطه غلیان |
141°C at 760 mmHg |
نقطه اشتعال |
61.6°C |
فشار بخار |
3.42mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|