ChemNet > CAS > 102-39-6 m-phenylenedioxydi(acetic acid)
102-39-6 m-phenylenedioxydi(acetic acid)
نام محصول |
m-phenylenedioxydi(acetic acid) |
نام انگلیسی |
m-phenylenedioxydi(acetic acid); Resorcinol-O,O-diacetic acid; 1,3-Bis(carboxymethoxy)benzene; Resorcinol-O,O-diacetic acid; 2,2'-[benzene-1,3-diylbis(oxy)]diacetic acid |
میدان مغناطیسی |
C10H10O6 |
وزن مولکولی |
226.1828 |
InChI |
InChI=1/C10H10O6/c11-9(12)5-15-7-2-1-3-8(4-7)16-6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14) |
شماره سیایاس |
102-39-6 |
تعداد کمیسیون اروپایی |
203-027-8 |
ساختار مولکولی |
|
تراکم |
1.416g/cm3 |
نقطه غلیان |
447.4°C at 760 mmHg |
ضریب شکست |
1.564 |
نقطه اشتعال |
180.4°C |
فشار بخار |
8.65E-09mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|