ChemNet > CAS > 10203-58-4 Diethyl isobutylmalonate
10203-58-4 Diethyl isobutylmalonate
| نام محصول |
Diethyl isobutylmalonate |
| نام انگلیسی |
Diethyl isobutylmalonate;Propanedioic acid, 2-(2-methylpropyl)-, 1,3-diethyl ester; AI3-05627; Malonic acid, isobutyl-, diethyl ester; NSC 68522; Propanedioic acid, (2-methylpropyl)-, diethyl ester; diethyl (2-methylpropyl)propanedioate; Isobutylmalonic Acid Diethyl Ester |
| میدان مغناطیسی |
C11H20O4 |
| وزن مولکولی |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-5-14-10(12)9(7-8(3)4)11(13)15-6-2/h8-9H,5-7H2,1-4H3 |
| شماره سیایاس |
10203-58-4 |
| تعداد کمیسیون اروپایی |
233-504-6 |
| ساختار مولکولی |
|
| تراکم |
0.992g/cm3 |
| نقطه غلیان |
255°C at 760 mmHg |
| ضریب شکست |
1.431 |
| نقطه اشتعال |
103.1°C |
| فشار بخار |
0.0167mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
