ChemNet > CAS > 10342-85-5 4-Piperidinoacetophenone
10342-85-5 4-Piperidinoacetophenone
| نام محصول |
4-Piperidinoacetophenone |
| نام انگلیسی |
4-Piperidinoacetophenone; N-(4-Acetylphenyl)piperidine; 1-[4-(piperidin-1-yl)phenyl]ethanone; 4'-PIPERIDINOACETOPHENONE |
| میدان مغناطیسی |
C13H17NO |
| وزن مولکولی |
203.2802 |
| InChI |
InChI=1/C13H17NO/c1-11(15)12-5-7-13(8-6-12)14-9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| شماره سیایاس |
10342-85-5 |
| تعداد کمیسیون اروپایی |
233-746-2 |
| ساختار مولکولی |
|
| تراکم |
1.052g/cm3 |
| نقطه ذوب |
84-90℃ |
| نقطه غلیان |
357.8°C at 760 mmHg |
| ضریب شکست |
1.545 |
| نقطه اشتعال |
140.2°C |
| فشار بخار |
2.66E-05mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
