ChemNet > CAS > 10352-88-2 ترانس 2-هپتنوئیک اسید؛ ؛ Heptenoicacidtech؛ hept-2-enoate؛ (2E) -hept-2-enoic اسید؛
10352-88-2 ترانس 2-هپتنوئیک اسید؛ ؛ Heptenoicacidtech؛ hept-2-enoate؛ (2E) -hept-2-enoic اسید؛
نام محصول |
ترانس 2-هپتنوئیک اسید؛ ؛ Heptenoicacidtech؛ hept-2-enoate؛ (2E) -hept-2-enoic اسید؛ |
نام انگلیسی |
trans-2-Heptenoic acid; Heptenoicacidtech; hept-2-enoate; (2E)-hept-2-enoic acid |
میدان مغناطیسی |
C7H12O2 |
وزن مولکولی |
128.169 |
InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h5-6H,2-4H2,1H3,(H,8,9)/b6-5+ |
شماره سیایاس |
10352-88-2 |
تعداد کمیسیون اروپایی |
233-769-8 |
ساختار مولکولی |
|
تراکم |
0.968g/cm3 |
نقطه غلیان |
226.6°C at 760 mmHg |
ضریب شکست |
1.457 |
نقطه اشتعال |
133.4°C |
فشار بخار |
0.0295mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|