10401-11-3 3-Hydroxyphenylacetylene

نام محصول	3-Hydroxyphenylacetylene
نام انگلیسی	3-Hydroxyphenylacetylene; 3-Ethynylphenol
میدان مغناطیسی	C₈H₆O
وزن مولکولی	118.1326
InChI	InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H
شماره سیایاس	10401-11-3
ساختار مولکولی
تراکم	1.12g/cm³
نقطه غلیان	230.9°C at 760 mmHg
ضریب شکست	1.589
نقطه اشتعال	106.1°C
فشار بخار	0.0424mmHg at 25°C
خطر نمادها
کدهای خطر	R36/38:Irritating to eyes and skin.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;