105-31-7 1-Hexyn-3-ol
نام محصول |
1-Hexyn-3-ol |
نام انگلیسی |
1-Hexyn-3-ol; Ethynyl n-propyl carbinol; hex-1-yn-3-ol; (3S)-hex-1-yn-3-ol; (3R)-hex-1-yn-3-ol |
میدان مغناطیسی |
C6H10O |
وزن مولکولی |
98.143 |
InChI |
InChI=1/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3/t6-/m0/s1 |
شماره سیایاس |
105-31-7 |
تعداد کمیسیون اروپایی |
203-286-7 |
ساختار مولکولی |
|
تراکم |
0.898g/cm3 |
نقطه غلیان |
140.3°C at 760 mmHg |
ضریب شکست |
1.446 |
نقطه اشتعال |
42.7°C |
فشار بخار |
2.54mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R25:Toxic if swallowed.;
R27:Very toxic in contact with skin.;
|
توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|