ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
| نام محصول |
ethyl (R)-(-)-mandelate |
| نام انگلیسی |
ethyl (R)-(-)-mandelate; (-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
| میدان مغناطیسی |
C10H12O3 |
| وزن مولکولی |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
| شماره سیایاس |
10606-72-1 |
| ساختار مولکولی |
|
| تراکم |
1.147g/cm3 |
| نقطه ذوب |
33-34℃ |
| نقطه غلیان |
254°C at 760 mmHg |
| ضریب شکست |
1.528 |
| نقطه اشتعال |
118.1°C |
| فشار بخار |
0.00918mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
