ChemNet > CAS > 1073-29-6 2-Hydroxythioanisole
1073-29-6 2-Hydroxythioanisole
| نام محصول |
2-Hydroxythioanisole |
| نام انگلیسی |
2-Hydroxythioanisole; 2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
| میدان مغناطیسی |
C7H8OS |
| وزن مولکولی |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| شماره سیایاس |
1073-29-6 |
| تعداد کمیسیون اروپایی |
214-027-2 |
| ساختار مولکولی |
|
| تراکم |
1.19g/cm3 |
| نقطه غلیان |
206.1°C at 760 mmHg |
| ضریب شکست |
1.613 |
| نقطه اشتعال |
108°C |
| فشار بخار |
0.168mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
