ChemNet > CAS > 108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
| نام محصول |
2-Methyl-5-phenylfuran-3-carboxylic acid |
| نام انگلیسی |
2-Methyl-5-phenylfuran-3-carboxylic acid; 2-Methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenylfuran-3-carboxylate |
| میدان مغناطیسی |
C12H9O3 |
| وزن مولکولی |
201.1986 |
| InChI |
InChI=1/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 |
| شماره سیایاس |
108124-17-0 |
| ساختار مولکولی |
|
| نقطه ذوب |
176-179℃ |
| نقطه غلیان |
357.1°C at 760 mmHg |
| نقطه اشتعال |
169.8°C |
| فشار بخار |
1.01E-05mmHg at 25°C |
| خطر نمادها |
Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|