ChemNet > CAS > 108847-20-7 Dibenzothiophene-4-boronic acid
108847-20-7 Dibenzothiophene-4-boronic acid
نام محصول |
Dibenzothiophene-4-boronic acid |
نام انگلیسی |
Dibenzothiophene-4-boronic acid; Dibenzo[b,d]thiophen-4-ylboronic acid; 4-Dibenzothienylboronic acid; 4-DIBENZOTHIOPHENEBORONIC ACID |
میدان مغناطیسی |
C12H9BO2S |
وزن مولکولی |
228.0747 |
InChI |
InChI=1/C12H9BO2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7,14-15H |
شماره سیایاس |
108847-20-7 |
ساختار مولکولی |
|
تراکم |
1.38g/cm3 |
نقطه ذوب |
327-330℃ |
نقطه غلیان |
480.2°C at 760 mmHg |
ضریب شکست |
1.738 |
نقطه اشتعال |
244.2°C |
فشار بخار |
4.97E-10mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S22:;
S24/25:;
|
|