110-49-6 2-Methoxyethyl acetate
نام محصول |
2-Methoxyethyl acetate |
نام انگلیسی |
2-Methoxyethyl acetate; Methyl Cellosolve?acetate; 1-Acetoxy-2-methoxyethane; Ethylene glycol monomethyl ether acetate; Methyl Cellosolve(rg acetate; 2-sulfanylethyl acetate |
میدان مغناطیسی |
C4H8O2S |
وزن مولکولی |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
شماره سیایاس |
110-49-6 |
تعداد کمیسیون اروپایی |
203-772-9 |
ساختار مولکولی |
|
تراکم |
1.072g/cm3 |
نقطه ذوب |
-65℃ |
نقطه غلیان |
162.7°C at 760 mmHg |
ضریب شکست |
1.452 |
نقطه اشتعال |
57.6°C |
فشار بخار |
2.14mmHg at 25°C |
خطر نمادها |
T:Toxic;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R60:May impair fertility.;
R61:May cause harm to the unborn child.;
|
توضیحات ایمنی |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|