ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
| نام محصول |
2,6-Dibromo-4-nitrotoluene |
| نام انگلیسی |
2,6-Dibromo-4-nitrotoluene;1,3-dibromo-2-methyl-5-nitrobenzene |
| میدان مغناطیسی |
C7H5Br2NO2 |
| وزن مولکولی |
294.9281 |
| InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| شماره سیایاس |
110127-07-6 |
| ساختار مولکولی |
|
| تراکم |
1.967g/cm3 |
| نقطه غلیان |
320.4°C at 760 mmHg |
| ضریب شکست |
1.625 |
| نقطه اشتعال |
147.6°C |
| فشار بخار |
0.000598mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
