ChemNet > CAS > 1108-42-5 2،4،7-trinitro-9H-fluoren-9-one - 3،4،7-trimethyl-1-benzothiophene (1: 1)
1108-42-5 2،4،7-trinitro-9H-fluoren-9-one - 3،4،7-trimethyl-1-benzothiophene (1: 1)
| نام محصول |
2،4،7-trinitro-9H-fluoren-9-one - 3،4،7-trimethyl-1-benzothiophene (1: 1) |
| مترادف |
; 2،4،7-Trinitrofluoren-9-one compd.with 3،4،7-trimethylbenzo(b)thiophene (1:1); فلورن-9-یک، 2،4،7-ترینیترو-، کامپد.با 3،4،7-تری متیل بنزو(ب)تیوفن (1:1) |
| نام انگلیسی |
2,4,7-trinitro-9H-fluoren-9-one - 3,4,7-trimethyl-1-benzothiophene (1:1); 2,4,7-Trinitrofluoren-9-one compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1); Fluoren-9-one, 2,4,7-trinitro-, compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1) |
| میدان مغناطیسی |
C24H17N3O7S |
| وزن مولکولی |
491.4727 |
| InChI |
InChI=1/C13H5N3O7.C11H12S/c17-13-9-3-6(14(18)19)1-2-8(9)12-10(13)4-7(15(20)21)5-11(12)16(22)23;1-7-4-5-8(2)11-10(7)9(3)6-12-11/h1-5H;4-6H,1-3H3 |
| شماره سیایاس |
1108-42-5 |
| ساختار مولکولی |
|
| نقطه غلیان |
561.7°C at 760 mmHg |
| نقطه اشتعال |
292.3°C |
| فشار بخار |
1.2E-12mmHg at 25°C |
|