1119-44-4 3-Hepten-2-one
نام محصول |
3-Hepten-2-one |
نام انگلیسی |
3-Hepten-2-one;AI3-22032; Butylideneacetone; FEMA No. 3400; Methyl pentenyl ketone; (3E)-hept-3-en-2-one |
میدان مغناطیسی |
C7H12O |
وزن مولکولی |
112.1696 |
InChI |
InChI=1/C7H12O/c1-3-4-5-6-7(2)8/h5-6H,3-4H2,1-2H3/b6-5+ |
شماره سیایاس |
1119-44-4 |
تعداد کمیسیون اروپایی |
214-278-8 |
ساختار مولکولی |
|
تراکم |
0.832g/cm3 |
نقطه غلیان |
157.8°C at 760 mmHg |
ضریب شکست |
1.426 |
نقطه اشتعال |
52.2°C |
فشار بخار |
2.7mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|