ChemNet > CAS > 112399-50-5 2-Bromo-5-fluorobenzyl bromide
112399-50-5 2-Bromo-5-fluorobenzyl bromide
| نام محصول |
2-Bromo-5-fluorobenzyl bromide |
| نام انگلیسی |
2-Bromo-5-fluorobenzyl bromide; 2-Bromo-5-fluorobenzylbromide; 1-bromo-2-(bromomethyl)-4-fluorobenzene; 5-Fluoro-2-Bromobenzyl Bromide |
| میدان مغناطیسی |
C7H5Br2F |
| وزن مولکولی |
267.921 |
| InChI |
InChI=1/C7H5Br2F/c8-4-5-3-6(10)1-2-7(5)9/h1-3H,4H2 |
| شماره سیایاس |
112399-50-5 |
| ساختار مولکولی |
|
| تراکم |
1.923g/cm3 |
| نقطه غلیان |
245.4°C at 760 mmHg |
| ضریب شکست |
1.583 |
| نقطه اشتعال |
102.2°C |
| فشار بخار |
0.045mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
