ChemNet > CAS > 1124-04-5 2-chloro-4,5-dimethylphenol
1124-04-5 2-chloro-4,5-dimethylphenol
| نام محصول |
2-chloro-4,5-dimethylphenol |
| نام انگلیسی |
2-chloro-4,5-dimethylphenol; 6-Chloro-3,4-xylenol (OH=1); 6-Chloro-3,4-xylenol |
| میدان مغناطیسی |
C8H9ClO |
| وزن مولکولی |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-5-3-7(9)8(10)4-6(5)2/h3-4,10H,1-2H3 |
| شماره سیایاس |
1124-04-5 |
| تعداد کمیسیون اروپایی |
214-386-5 |
| ساختار مولکولی |
|
| تراکم |
1.183g/cm3 |
| نقطه ذوب |
70-72℃ |
| نقطه غلیان |
237°C at 760 mmHg |
| ضریب شکست |
1.558 |
| نقطه اشتعال |
97.1°C |
| فشار بخار |
0.03mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
