1129-35-7 methyl 4-cyanobenzoate
نام محصول |
methyl 4-cyanobenzoate |
نام انگلیسی |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
میدان مغناطیسی |
C9H7NO2 |
وزن مولکولی |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
شماره سیایاس |
1129-35-7 |
تعداد کمیسیون اروپایی |
214-443-4 |
ساختار مولکولی |
|
تراکم |
1.18g/cm3 |
نقطه ذوب |
62℃ |
نقطه غلیان |
274.9°C at 760 mmHg |
ضریب شکست |
1.535 |
نقطه اشتعال |
131.2°C |
فشار بخار |
0.00526mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|