ChemNet > CAS > 114152-19-1 2,3,6-trifluorobenzyl alcohol
114152-19-1 2,3,6-trifluorobenzyl alcohol
نام محصول |
2,3,6-trifluorobenzyl alcohol |
نام انگلیسی |
2,3,6-trifluorobenzyl alcohol; |
میدان مغناطیسی |
C7H5F3O |
وزن مولکولی |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
شماره سیایاس |
114152-19-1 |
ساختار مولکولی |
|
تراکم |
1.398g/cm3 |
نقطه ذوب |
43-45℃ |
نقطه غلیان |
187°C at 760 mmHg |
ضریب شکست |
1.476 |
نقطه اشتعال |
80.8°C |
فشار بخار |
0.412mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|