نام محصول |
3,3',4',5,7-pentahydroxyflavone |
نام انگلیسی |
3,3',4',5,7-pentahydroxyflavone;C.I. 75670; C.I. Natural Yellow 10; Quercetin; 3,3,4,5,7-Pentahydroxyflavone (pract); 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one; 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one |
میدان مغناطیسی |
C15H10O6 |
وزن مولکولی |
286.2363 |
InChI |
InChI=1/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
شماره سیایاس |
117-39-5 |
تعداد کمیسیون اروپایی |
204-187-1 |
ساختار مولکولی |
|
تراکم |
1.654g/cm3 |
نقطه ذوب |
314-317℃ |
نقطه غلیان |
616.1°C at 760 mmHg |
ضریب شکست |
1.767 |
نقطه اشتعال |
239.5°C |
حلالیت آب |
<0.1 g/100 mL at 21℃ |
فشار بخار |
9.03E-16mmHg at 25°C |
خطر نمادها |
T:Toxic;
|
کدهای خطر |
R25:Toxic if swallowed.;
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|