ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
نام محصول |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
نام انگلیسی |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane; |
میدان مغناطیسی |
C7H11FO2 |
وزن مولکولی |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
شماره سیایاس |
1171-47-7 |
ساختار مولکولی |
|
تراکم |
1.159g/cm3 |
نقطه غلیان |
227.566°C at 760 mmHg |
ضریب شکست |
1.454 |
نقطه اشتعال |
91.429°C |
فشار بخار |
0.028mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|