ChemNet > CAS > 1186-52-3 Acetic-d3 acid-d
1186-52-3 Acetic-d3 acid-d
| نام محصول |
Acetic-d3 acid-d |
| نام انگلیسی |
Acetic-d3 acid-d; |
| میدان مغناطیسی |
C2D4O2 |
| وزن مولکولی |
64.0766 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| شماره سیایاس |
1186-52-3 |
| تعداد کمیسیون اروپایی |
214-693-4 |
| ساختار مولکولی |
|
| تراکم |
1.14g/cm3 |
| نقطه ذوب |
15-16℃ |
| نقطه غلیان |
117.1°C at 760 mmHg |
| ضریب شکست |
1.375 |
| نقطه اشتعال |
40°C |
| فشار بخار |
13.9mmHg at 25°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R10:Flammable.;
R35:Causes severe burns.;
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
