ChemNet > CAS > 1195-52-4 3-(3-Thienyl)acrylic acid
1195-52-4 3-(3-Thienyl)acrylic acid
نام محصول |
3-(3-Thienyl)acrylic acid |
نام انگلیسی |
3-(3-Thienyl)acrylic acid; Thiophene-3-acrylic acid; (2E)-3-thiophen-3-ylprop-2-enoate; (2Z)-3-(thiophen-3-yl)prop-2-enoic acid |
میدان مغناطیسی |
C7H6O2S |
وزن مولکولی |
154.1863 |
InChI |
InChI=1/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1- |
شماره سیایاس |
1195-52-4 |
تعداد کمیسیون اروپایی |
214-800-4 |
ساختار مولکولی |
|
تراکم |
1.346g/cm3 |
نقطه غلیان |
298.896°C at 760 mmHg |
ضریب شکست |
1.656 |
نقطه اشتعال |
134.568°C |
فشار بخار |
0.001mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|