ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
نام محصول |
4-(Dimethylamino)benzonitrile |
نام انگلیسی |
4-(Dimethylamino)benzonitrile; 4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
میدان مغناطیسی |
C9H10N2 |
وزن مولکولی |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
شماره سیایاس |
1197-19-9 |
تعداد کمیسیون اروپایی |
214-819-8 |
ساختار مولکولی |
|
تراکم |
1.04g/cm3 |
نقطه ذوب |
70-76℃ |
نقطه غلیان |
318.8°C at 760 mmHg |
ضریب شکست |
1.55 |
نقطه اشتعال |
145.4°C |
فشار بخار |
0.000353mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|