ChemNet > CAS > 120355-50-2 2,6-Dichloro-beta-nitrostyrene
120355-50-2 2,6-Dichloro-beta-nitrostyrene
نام محصول |
2,6-Dichloro-beta-nitrostyrene |
نام انگلیسی |
2,6-Dichloro-beta-nitrostyrene; 1-(2,6-Dichlorophenyl)-2-nitroethene; 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene |
میدان مغناطیسی |
C8H5Cl2NO2 |
وزن مولکولی |
218.0368 |
InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+ |
شماره سیایاس |
120355-50-2 |
ساختار مولکولی |
|
تراکم |
1.447g/cm3 |
نقطه غلیان |
330.6°C at 760 mmHg |
ضریب شکست |
1.626 |
نقطه اشتعال |
153.7°C |
فشار بخار |
0.000316mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|