ChemNet > CAS > 126771-41-3 4-(Bromomethyl)phenoxyacetic acid
126771-41-3 4-(Bromomethyl)phenoxyacetic acid
نام محصول |
4-(Bromomethyl)phenoxyacetic acid |
نام انگلیسی |
4-(Bromomethyl)phenoxyacetic acid; |
میدان مغناطیسی |
C9H9BrO3 |
وزن مولکولی |
245.07 |
InChI |
InChI=1/C9H9BrO3/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
شماره سیایاس |
126771-41-3 |
ساختار مولکولی |
|
تراکم |
1.59g/cm3 |
نقطه غلیان |
363°C at 760 mmHg |
ضریب شکست |
1.587 |
نقطه اشتعال |
173.3°C |
فشار بخار |
6.63E-06mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|