ChemNet > CAS > 127271-65-2 4-Fluoro-3-(trifluoromethyl)anisole
127271-65-2 4-Fluoro-3-(trifluoromethyl)anisole
| نام محصول |
4-Fluoro-3-(trifluoromethyl)anisole |
| نام انگلیسی |
4-Fluoro-3-(trifluoromethyl)anisole; 2-Fluoro-5-methoxybenzotrifluoride; 4-fluoro-3-trifluoromethylanisole; 1-fluoro-4-methoxy-2-(trifluoromethyl)benzene; 4-bromo-2-fluoro-1-propoxybenzene; 3-Trifluoromethyl-4-Fluoroanisole; 2-Fluoro-5-(trifluoromethyl)anisole |
| میدان مغناطیسی |
C9H10BrFO |
| وزن مولکولی |
233.0775 |
| InChI |
InChI=1/C9H10BrFO/c1-2-5-12-9-4-3-7(10)6-8(9)11/h3-4,6H,2,5H2,1H3 |
| شماره سیایاس |
127271-65-2 |
| ساختار مولکولی |
|
| تراکم |
1.397g/cm3 |
| نقطه غلیان |
251.471°C at 760 mmHg |
| ضریب شکست |
1.51 |
| نقطه اشتعال |
128.816°C |
| فشار بخار |
0.032mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
