ChemNet > CAS > 25154-52-3 4-(2,6-Dimethylheptyl)phenol(O and P)
25154-52-3;1300-16-9 4-(2,6-Dimethylheptyl)phenol(O and P)
نام محصول |
4-(2,6-Dimethylheptyl)phenol(O and P) |
نام انگلیسی |
4-(2,6-Dimethylheptyl)phenol(O and P); 2,6-dimethyl-4-heptylphenol,(oandp); hydroxylno.253; monononylphenol; n-nonylphenol; nonyl; nonyl-pheno; nonylphenol(isomermixture); nonylphenol; Nonyl phenol; potassium 2-nonylphenolate; strontium bis(2-nonylphenolate); sodium 2-nonylphenolate; 4-(2,6-dimethylheptyl)phenol; 4-(1,3,5-trimethylhexyl)phenol |
میدان مغناطیسی |
C15H24O |
وزن مولکولی |
220.3505 |
InChI |
InChI=1/C15H24O/c1-11(2)9-12(3)10-13(4)14-5-7-15(16)8-6-14/h5-8,11-13,16H,9-10H2,1-4H3 |
شماره سیایاس |
25154-52-3;1300-16-9 |
تعداد کمیسیون اروپایی |
246-672-0 |
ساختار مولکولی |
|
تراکم |
0.926g/cm3 |
نقطه ذوب |
-8℃ |
نقطه غلیان |
306.7°C at 760 mmHg |
ضریب شکست |
1.5 |
نقطه اشتعال |
156.2°C |
حلالیت آب |
6 mg l-1 |
فشار بخار |
0.000418mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|