ChemNet > CAS > 13029-09-9 2,2'-Dibromobiphenyl
13029-09-9 2,2'-Dibromobiphenyl
| نام محصول |
2,2'-Dibromobiphenyl |
| نام انگلیسی |
2,2'-Dibromobiphenyl; 2,2-Dibromophenyl; 2,2-Dibromobiphenyl; 2,2'-dibromodiphenyl; 2,2'-Dibromo-1,1'-Biphenyl |
| میدان مغناطیسی |
C12H8Br2 |
| وزن مولکولی |
311.9999 |
| InChI |
InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| شماره سیایاس |
13029-09-9 |
| ساختار مولکولی |
|
| تراکم |
1.667g/cm3 |
| نقطه ذوب |
79℃ |
| نقطه غلیان |
332.9°C at 760 mmHg |
| ضریب شکست |
1.625 |
| نقطه اشتعال |
180°C |
| فشار بخار |
0.000274mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
