ChemNet > CAS > 131076-14-7 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride
131076-14-7 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride
| نام محصول |
4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride |
| نام انگلیسی |
4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride; 1,2-Diamino-4,5-dimethoxybenzene, dihydrochloride (DDB); 4,5-dimethoxybenzene-1,2-diamine dihydrochloride |
| میدان مغناطیسی |
C8H14Cl2N2O2 |
| وزن مولکولی |
241.115 |
| InChI |
InChI=1/C8H12N2O2.2ClH/c1-11-7-3-5(9)6(10)4-8(7)12-2;;/h3-4H,9-10H2,1-2H3;2*1H |
| شماره سیایاس |
131076-14-7 |
| ساختار مولکولی |
|
| نقطه غلیان |
385.7°C at 760 mmHg |
| نقطه اشتعال |
187.1°C |
| فشار بخار |
2.51E-06mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
