ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
| نام محصول |
Difluoromandelicacid |
| نام انگلیسی |
Difluoromandelicacid; 3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
| میدان مغناطیسی |
C8H6F2O3 |
| وزن مولکولی |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| شماره سیایاس |
132741-29-8 |
| ساختار مولکولی |
|
| تراکم |
1.522g/cm3 |
| نقطه ذوب |
92-94℃ |
| نقطه غلیان |
320.7°C at 760 mmHg |
| ضریب شکست |
1.542 |
| نقطه اشتعال |
147.8°C |
| فشار بخار |
0.000129mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
