ChemNet > CAS > 132898-95-4 2،2'-bithiophene-5-اسید بورونیک؛ 2،2'-bithiophen-5-ایلبورونیک اسید؛
132898-95-4 2،2'-bithiophene-5-اسید بورونیک؛ 2،2'-bithiophen-5-ایلبورونیک اسید؛
| نام محصول |
2،2'-bithiophene-5-اسید بورونیک؛ 2،2'-bithiophen-5-ایلبورونیک اسید؛ |
| نام انگلیسی |
2,2'-bithiophene-5-boronic acid;2,2'-bithiophen-5-ylboronic acid |
| میدان مغناطیسی |
C8H7BO2S2 |
| وزن مولکولی |
210.081 |
| InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
| شماره سیایاس |
132898-95-4 |
| ساختار مولکولی |
|
| تراکم |
1.42g/cm3 |
| نقطه ذوب |
127℃ |
| نقطه غلیان |
416.1°C at 760 mmHg |
| ضریب شکست |
1.658 |
| نقطه اشتعال |
205.5°C |
| فشار بخار |
1.14E-07mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
