132980-99-5 3,5-difluorobenzamide
نام محصول |
3,5-difluorobenzamide |
نام انگلیسی |
3,5-difluorobenzamide; Difluorobenzamide6 |
میدان مغناطیسی |
C7H5F2NO |
وزن مولکولی |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
شماره سیایاس |
132980-99-5 |
ساختار مولکولی |
|
تراکم |
1.348g/cm3 |
نقطه ذوب |
155-157℃ |
نقطه غلیان |
187.7°C at 760 mmHg |
ضریب شکست |
1.515 |
نقطه اشتعال |
67.3°C |
فشار بخار |
0.622mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|