ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
نام محصول |
Dimethyl 3-nitrophthalate |
نام انگلیسی |
Dimethyl 3-nitrophthalate; 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
میدان مغناطیسی |
C10H9NO6 |
وزن مولکولی |
239.1816 |
InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
شماره سیایاس |
13365-26-9 |
ساختار مولکولی |
|
تراکم |
1.35g/cm3 |
نقطه غلیان |
314.6°C at 760 mmHg |
ضریب شکست |
1.549 |
نقطه اشتعال |
134.3°C |
فشار بخار |
0.000462mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|