ChemNet > CAS > 13388-75-5 3,5-Dimethoxyphenylacetonitrile
13388-75-5 3,5-Dimethoxyphenylacetonitrile
نام محصول |
3,5-Dimethoxyphenylacetonitrile |
نام انگلیسی |
3,5-Dimethoxyphenylacetonitrile; |
میدان مغناطیسی |
C10H11NO2 |
وزن مولکولی |
177.1998 |
InChI |
InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
شماره سیایاس |
13388-75-5 |
تعداد کمیسیون اروپایی |
202-225-1 |
ساختار مولکولی |
|
تراکم |
1.082g/cm3 |
نقطه غلیان |
316.7°C at 760 mmHg |
ضریب شکست |
1.511 |
نقطه اشتعال |
127.3°C |
فشار بخار |
0.000404mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|