135-00-2 2-Benzoylthiophene
نام محصول |
2-Benzoylthiophene |
نام انگلیسی |
2-Benzoylthiophene; 2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
میدان مغناطیسی |
C11H8OS |
وزن مولکولی |
188.2456 |
InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
شماره سیایاس |
135-00-2 |
تعداد کمیسیون اروپایی |
205-169-6 |
ساختار مولکولی |
|
تراکم |
1.198g/cm3 |
نقطه غلیان |
300°C at 760 mmHg |
ضریب شکست |
1.609 |
نقطه اشتعال |
139.7°C |
فشار بخار |
0.00115mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|