135-01-3 1,2-diethylbenzene
نام محصول |
1,2-diethylbenzene |
نام انگلیسی |
1,2-diethylbenzene; Diethylbenzene; o-Diethylbenzene |
میدان مغناطیسی |
C10H14 |
وزن مولکولی |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
شماره سیایاس |
135-01-3 |
تعداد کمیسیون اروپایی |
205-170-1 |
ساختار مولکولی |
|
تراکم |
0.865g/cm3 |
نقطه غلیان |
183.5°C at 760 mmHg |
ضریب شکست |
1.496 |
نقطه اشتعال |
49.4°C |
فشار بخار |
1.05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|