ChemNet > CAS > 135145-90-3 2,5-Dichlorobenzeneboronic acid
135145-90-3 2,5-Dichlorobenzeneboronic acid
| نام محصول |
2,5-Dichlorobenzeneboronic acid |
| نام انگلیسی |
2,5-Dichlorobenzeneboronic acid; 2,5-Dichlorophenylboronic acid |
| میدان مغناطیسی |
C6H5BCl2O2 |
| وزن مولکولی |
190.8197 |
| InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
| شماره سیایاس |
135145-90-3 |
| ساختار مولکولی |
|
| تراکم |
1.47g/cm3 |
| نقطه ذوب |
150℃ |
| نقطه غلیان |
343.6°C at 760 mmHg |
| ضریب شکست |
1.577 |
| نقطه اشتعال |
161.6°C |
| فشار بخار |
2.65E-05mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
