ChemNet > CAS > 135306-45-5 3,5-difluoropropiophenone
135306-45-5 3,5-difluoropropiophenone
| نام محصول |
3,5-difluoropropiophenone |
| نام انگلیسی |
3,5-difluoropropiophenone; 1-(3,5-difluorophenyl)propan-1-one; 1-(3,5-difluorophenyl)propan-2-one |
| میدان مغناطیسی |
C9H8F2O |
| وزن مولکولی |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
| شماره سیایاس |
135306-45-5 |
| ساختار مولکولی |
|
| تراکم |
1.179g/cm3 |
| نقطه ذوب |
25-27℃ |
| نقطه غلیان |
191.5°C at 760 mmHg |
| ضریب شکست |
1.472 |
| نقطه اشتعال |
70.6°C |
| فشار بخار |
0.513mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
