ChemNet > CAS > 13991-08-7 1,2-Bis(dimethylphosphino)benzene
13991-08-7 1,2-Bis(dimethylphosphino)benzene
نام محصول |
1,2-Bis(dimethylphosphino)benzene |
نام انگلیسی |
1,2-Bis(dimethylphosphino)benzene; 1,2-Bis(diphenylphosphino)benzene; benzene-1,2-diylbis(diphenylphosphane) |
میدان مغناطیسی |
C30H24P2 |
وزن مولکولی |
446.4591 |
InChI |
InChI=1/C30H24P2/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-24H |
شماره سیایاس |
13991-08-7 |
ساختار مولکولی |
|
نقطه ذوب |
185-187℃ |
نقطه غلیان |
546.942°C at 760 mmHg |
نقطه اشتعال |
302.787°C |
فشار بخار |
0mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|