1422-54-4 2-Bromo-6-fluorotoluene
نام محصول |
2-Bromo-6-fluorotoluene |
نام انگلیسی |
2-Bromo-6-fluorotoluene; Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
میدان مغناطیسی |
C7H4ClFN2S |
وزن مولکولی |
202.6365 |
InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
شماره سیایاس |
1422-54-4 |
ساختار مولکولی |
|
تراکم |
1.63g/cm3 |
نقطه غلیان |
294°C at 760 mmHg |
ضریب شکست |
1.714 |
نقطه اشتعال |
131.6°C |
فشار بخار |
0.00166mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|