ChemNet > CAS > 14444-77-0 Diethyl phenyl orthoformate
14444-77-0 Diethyl phenyl orthoformate
| نام محصول |
Diethyl phenyl orthoformate |
| نام انگلیسی |
Diethyl phenyl orthoformate; Orthoformic acid diethyl phenyl ester; (diethoxymethoxy)benzene |
| میدان مغناطیسی |
C11H16O3 |
| وزن مولکولی |
196.2429 |
| InChI |
InChI=1/C11H16O3/c1-3-12-11(13-4-2)14-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| شماره سیایاس |
14444-77-0 |
| تعداد کمیسیون اروپایی |
238-421-9 |
| ساختار مولکولی |
|
| تراکم |
1.019g/cm3 |
| نقطه غلیان |
235.2°C at 760 mmHg |
| ضریب شکست |
1.482 |
| نقطه اشتعال |
57.2°C |
| فشار بخار |
0.0777mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
