ChemNet > CAS > 145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
| نام محصول |
Methyl 2,5-dichlorothiophene-3-carboxylate |
| نام انگلیسی |
Methyl 2,5-dichlorothiophene-3-carboxylate; 2,5-Dichlorothiophene-3-carboxylic acid methyl ester |
| میدان مغناطیسی |
C6H4Cl2O2S |
| وزن مولکولی |
211.0658 |
| InChI |
InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3 |
| شماره سیایاس |
145129-54-0 |
| ساختار مولکولی |
|
| تراکم |
1.5g/cm3 |
| نقطه غلیان |
257.3°C at 760 mmHg |
| ضریب شکست |
1.57 |
| نقطه اشتعال |
109.4°C |
| فشار بخار |
0.0146mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
