ChemNet > CAS > 1458-18-0 methyl 3-amino-5,6-dichloro-2-pyrazine-carboxylat
1458-18-0 methyl 3-amino-5,6-dichloro-2-pyrazine-carboxylat
| نام محصول |
methyl 3-amino-5,6-dichloro-2-pyrazine-carboxylat |
| نام انگلیسی |
methyl 3-amino-5,6-dichloro-2-pyrazine-carboxylat; Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate; 3-Amino-5,6-Dichloropyrazine-2-Carboxylic Acid Methyl Ester; methyl 3-amino-5,6-dichloropyrazine-2-carboxylate |
| میدان مغناطیسی |
C6H5Cl2N3O2 |
| وزن مولکولی |
222.0288 |
| InChI |
InChI=1/C6H5Cl2N3O2/c1-13-6(12)2-5(9)11-4(8)3(7)10-2/h1H3,(H2,9,11) |
| شماره سیایاس |
1458-18-0 |
| تعداد کمیسیون اروپایی |
215-947-7 |
| ساختار مولکولی |
|
| تراکم |
1.586g/cm3 |
| نقطه ذوب |
230-233℃ |
| نقطه غلیان |
357.3°C at 760 mmHg |
| ضریب شکست |
1.605 |
| نقطه اشتعال |
169.9°C |
| فشار بخار |
2.76E-05mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
