ChemNet > CAS > 146132-95-8 3،5،7-Trihydroxy-3'، 4'، 5'-trimethoxyflavone؛ ؛ تری متیل اتر Myricetin؛ 3،5،7-trihydroxy-2- (3،4،5-trimethoxyphenyl) -4H-chromen-4-one؛
146132-95-8 3،5،7-Trihydroxy-3'، 4'، 5'-trimethoxyflavone؛ ؛ تری متیل اتر Myricetin؛ 3،5،7-trihydroxy-2- (3،4،5-trimethoxyphenyl) -4H-chromen-4-one؛
نام محصول |
3،5،7-Trihydroxy-3'، 4'، 5'-trimethoxyflavone؛ ؛ تری متیل اتر Myricetin؛ 3،5،7-trihydroxy-2- (3،4،5-trimethoxyphenyl) -4H-chromen-4-one؛ |
نام انگلیسی |
3,5,7-Trihydroxy-3',4',5'-trimethoxyflavone; Myricetin trimethyl ether; 3,5,7-trihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
میدان مغناطیسی |
C18H16O8 |
وزن مولکولی |
360.3148 |
InChI |
InChI=1/C18H16O8/c1-23-12-4-8(5-13(24-2)18(12)25-3)17-16(22)15(21)14-10(20)6-9(19)7-11(14)26-17/h4-7,19-20,22H,1-3H3 |
شماره سیایاس |
146132-95-8 |
ساختار مولکولی |
|
تراکم |
1.482g/cm3 |
نقطه غلیان |
585.2°C at 760 mmHg |
ضریب شکست |
1.658 |
نقطه اشتعال |
213.9°C |
فشار بخار |
2.71E-14mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|